C12H13N3O — CID 67311804
6-phenylmethoxypyridine-2,3-diamine (PubChem CID 67311804) has the molecular formula C12H13N3O and a molecular weight of 215.26 g/mol. Its IUPAC name is 6-phenylmethoxypyridine-2,3-diamine.
| Compound Name | 6-phenylmethoxypyridine-2,3-diamine |
|---|---|
| PubChem CID | 67311804 |
| Molecular Formula | C12H13N3O |
| Molecular Weight | 215.26 g/mol |
| Exact Mass | 215.11 |
| IUPAC Name | 6-phenylmethoxypyridine-2,3-diamine |
| SMILES | Nc1ccc(OCc2ccccc2)nc1N |
| InChI | InChI=1S/C12H13N3O/c13-10-6-7-11(15-12(10)14)16-8-9-4-2-1-3-5-9/h1-7H,8,13H2,(H2,14,15) |
| InChIKey | MOJLRMBKLOEZFR-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 74.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.26 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |