C13H15N3O2 — CID 59437374
6-[(4-methoxyphenyl)methoxy]pyridine-2,3-diamine (PubChem CID 59437374) has the molecular formula C13H15N3O2 and a molecular weight of 245.28 g/mol. Its IUPAC name is 6-[(4-methoxyphenyl)methoxy]pyridine-2,3-diamine.
| Compound Name | 6-[(4-methoxyphenyl)methoxy]pyridine-2,3-diamine |
|---|---|
| PubChem CID | 59437374 |
| Molecular Formula | C13H15N3O2 |
| Molecular Weight | 245.28 g/mol |
| Exact Mass | 245.12 |
| IUPAC Name | 6-[(4-methoxyphenyl)methoxy]pyridine-2,3-diamine |
| SMILES | COc1ccc(COc2ccc(N)c(N)n2)cc1 |
| InChI | InChI=1S/C13H15N3O2/c1-17-10-4-2-9(3-5-10)8-18-12-7-6-11(14)13(15)16-12/h2-7H,8,14H2,1H3,(H2,15,16) |
| InChIKey | IMXZCQKFSVLKOK-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 83.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.28 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |