C16H15N3O3 — CID 59437364
3-methoxy-6-[(4-methoxyphenyl)methoxy]pyrido[2,3-b]pyrazine (PubChem CID 59437364) has the molecular formula C16H15N3O3 and a molecular weight of 297.31 g/mol. Its IUPAC name is 3-methoxy-6-[(4-methoxyphenyl)methoxy]pyrido[2,3-b]pyrazine.
| Compound Name | 3-methoxy-6-[(4-methoxyphenyl)methoxy]pyrido[2,3-b]pyrazine |
|---|---|
| PubChem CID | 59437364 |
| Molecular Formula | C16H15N3O3 |
| Molecular Weight | 297.31 g/mol |
| Exact Mass | 297.11 |
| IUPAC Name | 3-methoxy-6-[(4-methoxyphenyl)methoxy]pyrido[2,3-b]pyrazine |
| SMILES | COc1ccc(COc2ccc3ncc(OC)nc3n2)cc1 |
| InChI | InChI=1S/C16H15N3O3/c1-20-12-5-3-11(4-6-12)10-22-14-8-7-13-16(18-14)19-15(21-2)9-17-13/h3-9H,10H2,1-2H3 |
| InChIKey | SOPYLRYFDOBCHD-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 66.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.31 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |