C13H10N2OS — CID 141304726
5-phenylmethoxy-[1,3]thiazolo[5,4-b]pyridine (PubChem CID 141304726) has the molecular formula C13H10N2OS and a molecular weight of 242.30 g/mol. Its IUPAC name is 5-phenylmethoxy-[1,3]thiazolo[5,4-b]pyridine.
| Compound Name | 5-phenylmethoxy-[1,3]thiazolo[5,4-b]pyridine |
|---|---|
| PubChem CID | 141304726 |
| Molecular Formula | C13H10N2OS |
| Molecular Weight | 242.30 g/mol |
| Exact Mass | 242.05 |
| IUPAC Name | 5-phenylmethoxy-[1,3]thiazolo[5,4-b]pyridine |
| SMILES | c1ccc(COc2ccc3ncsc3n2)cc1 |
| InChI | InChI=1S/C13H10N2OS/c1-2-4-10(5-3-1)8-16-12-7-6-11-13(15-12)17-9-14-11/h1-7,9H,8H2 |
| InChIKey | ZMYWWCNMEJGOKC-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.30 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |