C17H18N2OS — CID 58088073
2-tert-butyl-5-phenylmethoxy-[1,3]thiazolo[5,4-b]pyridine (PubChem CID 58088073) has the molecular formula C17H18N2OS and a molecular weight of 298.41 g/mol. Its IUPAC name is 2-tert-butyl-5-phenylmethoxy-[1,3]thiazolo[5,4-b]pyridine.
| Compound Name | 2-tert-butyl-5-phenylmethoxy-[1,3]thiazolo[5,4-b]pyridine |
|---|---|
| PubChem CID | 58088073 |
| Molecular Formula | C17H18N2OS |
| Molecular Weight | 298.41 g/mol |
| Exact Mass | 298.11 |
| IUPAC Name | 2-tert-butyl-5-phenylmethoxy-[1,3]thiazolo[5,4-b]pyridine |
| SMILES | CC(C)(C)c1nc2ccc(OCc3ccccc3)nc2s1 |
| InChI | InChI=1S/C17H18N2OS/c1-17(2,3)16-18-13-9-10-14(19-15(13)21-16)20-11-12-7-5-4-6-8-12/h4-10H,11H2,1-3H3 |
| InChIKey | ZCUXSHMJEODHRN-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.41 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |