C19H28N4O2 — CID 58516203
8-[5-(diethylamino)pentylamino]-6-hydroxyquinoline-5-carboxamide (PubChem CID 58516203) has the molecular formula C19H28N4O2 and a molecular weight of 344.46 g/mol. Its IUPAC name is 8-[5-(diethylamino)pentylamino]-6-hydroxyquinoline-5-carboxamide.
| Compound Name | 8-[5-(diethylamino)pentylamino]-6-hydroxyquinoline-5-carboxamide |
|---|---|
| PubChem CID | 58516203 |
| Molecular Formula | C19H28N4O2 |
| Molecular Weight | 344.46 g/mol |
| Exact Mass | 344.22 |
| IUPAC Name | 8-[5-(diethylamino)pentylamino]-6-hydroxyquinoline-5-carboxamide |
| SMILES | CCN(CC)CCCCCNc1cc(O)c(C(N)=O)c2cccnc12 |
| InChI | InChI=1S/C19H28N4O2/c1-3-23(4-2)12-7-5-6-10-21-15-13-16(24)17(19(20)25)14-9-8-11-22-18(14)15/h8-9,11,13,21,24H,3-7,10,12H2,1-2H3,(H2,20,25) |
| InChIKey | OFLVXAVSQDXLMC-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 91.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.46 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|