C17H23N5S — CID 110432281
N',N'-diethyl-N-(8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-6-yl)butane-1,4-diamine (PubChem CID 110432281) has the molecular formula C17H23N5S and a molecular weight of 329.47 g/mol. Its IUPAC name is N',N'-diethyl-N-(8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-6-yl)butane-1,4-diamine.
| Compound Name | N',N'-diethyl-N-(8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-6-yl)butane-1,4-diamine |
|---|---|
| PubChem CID | 110432281 |
| Molecular Formula | C17H23N5S |
| Molecular Weight | 329.47 g/mol |
| Exact Mass | 329.17 |
| IUPAC Name | N',N'-diethyl-N-(8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-6-yl)butane-1,4-diamine |
| SMILES | CCN(CC)CCCCNc1ncnc2c1sc1ncccc12 |
| InChI | InChI=1S/C17H23N5S/c1-3-22(4-2)11-6-5-9-18-16-15-14(20-12-21-16)13-8-7-10-19-17(13)23-15/h7-8,10,12H,3-6,9,11H2,1-2H3,(H,18,20,21) |
| InChIKey | KNXBVSZISUFWNT-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 53.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.47 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|