C17H12N4OS — CID 110435109
1-[3-(8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-6-ylamino)phenyl]ethanone (PubChem CID 110435109) has the molecular formula C17H12N4OS and a molecular weight of 320.38 g/mol. Its IUPAC name is 1-[3-(8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-6-ylamino)phenyl]ethanone.
| Compound Name | 1-[3-(8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-6-ylamino)phenyl]ethanone |
|---|---|
| PubChem CID | 110435109 |
| Molecular Formula | C17H12N4OS |
| Molecular Weight | 320.38 g/mol |
| Exact Mass | 320.07 |
| IUPAC Name | 1-[3-(8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-6-ylamino)phenyl]ethanone |
| SMILES | CC(=O)c1cccc(Nc2ncnc3c2sc2ncccc23)c1 |
| InChI | InChI=1S/C17H12N4OS/c1-10(22)11-4-2-5-12(8-11)21-16-15-14(19-9-20-16)13-6-3-7-18-17(13)23-15/h2-9H,1H3,(H,19,20,21) |
| InChIKey | HKUBFKIOXXXTHM-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.38 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |