C16H15N3OS — CID 21011274
1-[3-[(6-ethylthieno[2,3-d]pyrimidin-4-yl)amino]phenyl]ethanone (PubChem CID 21011274) has the molecular formula C16H15N3OS and a molecular weight of 297.38 g/mol. Its IUPAC name is 1-[3-[(6-ethylthieno[2,3-d]pyrimidin-4-yl)amino]phenyl]ethanone.
| Compound Name | 1-[3-[(6-ethylthieno[2,3-d]pyrimidin-4-yl)amino]phenyl]ethanone |
|---|---|
| PubChem CID | 21011274 |
| Molecular Formula | C16H15N3OS |
| Molecular Weight | 297.38 g/mol |
| Exact Mass | 297.09 |
| IUPAC Name | 1-[3-[(6-ethylthieno[2,3-d]pyrimidin-4-yl)amino]phenyl]ethanone |
| SMILES | CCc1cc2c(Nc3cccc(C(C)=O)c3)ncnc2s1 |
| InChI | InChI=1S/C16H15N3OS/c1-3-13-8-14-15(17-9-18-16(14)21-13)19-12-6-4-5-11(7-12)10(2)20/h4-9H,3H2,1-2H3,(H,17,18,19) |
| InChIKey | WEMJZIUWKOXQGJ-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.38 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |