C20H25N3OS — CID 21012213
6-ethyl-N-(4-hexoxyphenyl)thieno[2,3-d]pyrimidin-4-amine (PubChem CID 21012213) has the molecular formula C20H25N3OS and a molecular weight of 355.51 g/mol. Its IUPAC name is 6-ethyl-N-(4-hexoxyphenyl)thieno[2,3-d]pyrimidin-4-amine.
| Compound Name | 6-ethyl-N-(4-hexoxyphenyl)thieno[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 21012213 |
| Molecular Formula | C20H25N3OS |
| Molecular Weight | 355.51 g/mol |
| Exact Mass | 355.17 |
| IUPAC Name | 6-ethyl-N-(4-hexoxyphenyl)thieno[2,3-d]pyrimidin-4-amine |
| SMILES | CCCCCCOc1ccc(Nc2ncnc3sc(CC)cc23)cc1 |
| InChI | InChI=1S/C20H25N3OS/c1-3-5-6-7-12-24-16-10-8-15(9-11-16)23-19-18-13-17(4-2)25-20(18)22-14-21-19/h8-11,13-14H,3-7,12H2,1-2H3,(H,21,22,23) |
| InChIKey | AZKZBBWVSNJIGH-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.51 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|