C24H38N4O — CID 58516197
2-(cyclohexylamino)-8-[5-(diethylamino)pentylamino]quinolin-6-ol (PubChem CID 58516197) has the molecular formula C24H38N4O and a molecular weight of 398.60 g/mol. Its IUPAC name is 2-(cyclohexylamino)-8-[5-(diethylamino)pentylamino]quinolin-6-ol.
| Compound Name | 2-(cyclohexylamino)-8-[5-(diethylamino)pentylamino]quinolin-6-ol |
|---|---|
| PubChem CID | 58516197 |
| Molecular Formula | C24H38N4O |
| Molecular Weight | 398.60 g/mol |
| Exact Mass | 398.30 |
| IUPAC Name | 2-(cyclohexylamino)-8-[5-(diethylamino)pentylamino]quinolin-6-ol |
| SMILES | CCN(CC)CCCCCNc1cc(O)cc2ccc(NC3CCCCC3)nc12 |
| InChI | InChI=1S/C24H38N4O/c1-3-28(4-2)16-10-6-9-15-25-22-18-21(29)17-19-13-14-23(27-24(19)22)26-20-11-7-5-8-12-20/h13-14,17-18,20,25,29H,3-12,15-16H2,1-2H3,(H,26,27) |
| InChIKey | PXWHXMLQHGDRIY-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 60.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.60 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|