C16H27N3 — CID 80786169
6-N-cyclooctyl-2-N-propylpyridine-2,6-diamine (PubChem CID 80786169) has the molecular formula C16H27N3 and a molecular weight of 261.41 g/mol. Its IUPAC name is 6-N-cyclooctyl-2-N-propylpyridine-2,6-diamine.
| Compound Name | 6-N-cyclooctyl-2-N-propylpyridine-2,6-diamine |
|---|---|
| PubChem CID | 80786169 |
| Molecular Formula | C16H27N3 |
| Molecular Weight | 261.41 g/mol |
| Exact Mass | 261.22 |
| IUPAC Name | 6-N-cyclooctyl-2-N-propylpyridine-2,6-diamine |
| SMILES | CCCNc1cccc(NC2CCCCCCC2)n1 |
| InChI | InChI=1S/C16H27N3/c1-2-13-17-15-11-8-12-16(19-15)18-14-9-6-4-3-5-7-10-14/h8,11-12,14H,2-7,9-10,13H2,1H3,(H2,17,18,19) |
| InChIKey | JQOVTIYCEUUMSJ-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.41 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |