C17H21N3 — CID 107855439
6-N-(2,3-dihydro-1H-inden-2-yl)-2-N-propylpyridine-2,6-diamine (PubChem CID 107855439) has the molecular formula C17H21N3 and a molecular weight of 267.38 g/mol. Its IUPAC name is 6-N-(2,3-dihydro-1H-inden-2-yl)-2-N-propylpyridine-2,6-diamine.
| Compound Name | 6-N-(2,3-dihydro-1H-inden-2-yl)-2-N-propylpyridine-2,6-diamine |
|---|---|
| PubChem CID | 107855439 |
| Molecular Formula | C17H21N3 |
| Molecular Weight | 267.38 g/mol |
| Exact Mass | 267.17 |
| IUPAC Name | 6-N-(2,3-dihydro-1H-inden-2-yl)-2-N-propylpyridine-2,6-diamine |
| SMILES | CCCNc1cccc(NC2Cc3ccccc3C2)n1 |
| InChI | InChI=1S/C17H21N3/c1-2-10-18-16-8-5-9-17(20-16)19-15-11-13-6-3-4-7-14(13)12-15/h3-9,15H,2,10-12H2,1H3,(H2,18,19,20) |
| InChIKey | RKACZSTVLSZZNC-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.38 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |