C14H23N3S — CID 113488450
2-N-propyl-6-N-(thian-4-ylmethyl)pyridine-2,6-diamine (PubChem CID 113488450) has the molecular formula C14H23N3S and a molecular weight of 265.43 g/mol. Its IUPAC name is 2-N-propyl-6-N-(thian-4-ylmethyl)pyridine-2,6-diamine.
| Compound Name | 2-N-propyl-6-N-(thian-4-ylmethyl)pyridine-2,6-diamine |
|---|---|
| PubChem CID | 113488450 |
| Molecular Formula | C14H23N3S |
| Molecular Weight | 265.43 g/mol |
| Exact Mass | 265.16 |
| IUPAC Name | 2-N-propyl-6-N-(thian-4-ylmethyl)pyridine-2,6-diamine |
| SMILES | CCCNc1cccc(NCC2CCSCC2)n1 |
| InChI | InChI=1S/C14H23N3S/c1-2-8-15-13-4-3-5-14(17-13)16-11-12-6-9-18-10-7-12/h3-5,12H,2,6-11H2,1H3,(H2,15,16,17) |
| InChIKey | WDQCLLRELNVJRG-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.43 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |