C24H36N6 — CID 100984113
2-N,9-N-bis[2-(diethylamino)ethyl]-1,10-phenanthroline-2,9-diamine (PubChem CID 100984113) has the molecular formula C24H36N6 and a molecular weight of 408.59 g/mol. Its IUPAC name is 2-N,9-N-bis[2-(diethylamino)ethyl]-1,10-phenanthroline-2,9-diamine.
| Compound Name | 2-N,9-N-bis[2-(diethylamino)ethyl]-1,10-phenanthroline-2,9-diamine |
|---|---|
| PubChem CID | 100984113 |
| Molecular Formula | C24H36N6 |
| Molecular Weight | 408.59 g/mol |
| Exact Mass | 408.30 |
| IUPAC Name | 2-N,9-N-bis[2-(diethylamino)ethyl]-1,10-phenanthroline-2,9-diamine |
| SMILES | CCN(CC)CCNc1ccc2ccc3ccc(NCCN(CC)CC)nc3c2n1 |
| InChI | InChI=1S/C24H36N6/c1-5-29(6-2)17-15-25-21-13-11-19-9-10-20-12-14-22(28-24(20)23(19)27-21)26-16-18-30(7-3)8-4/h9-14H,5-8,15-18H2,1-4H3,(H,25,27)(H,26,28) |
| InChIKey | AKNQKIXPQZMRQE-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 56.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.59 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|