C21H35N3O2 — CID 20979535
N-ethylethanamine;[8-(hexylamino)-6-methoxyquinolin-4-yl]methanol (PubChem CID 20979535) has the molecular formula C21H35N3O2 and a molecular weight of 361.53 g/mol. Its IUPAC name is N-ethylethanamine;[8-(hexylamino)-6-methoxyquinolin-4-yl]methanol.
| Compound Name | N-ethylethanamine;[8-(hexylamino)-6-methoxyquinolin-4-yl]methanol |
|---|---|
| PubChem CID | 20979535 |
| Molecular Formula | C21H35N3O2 |
| Molecular Weight | 361.53 g/mol |
| Exact Mass | 361.27 |
| IUPAC Name | N-ethylethanamine;[8-(hexylamino)-6-methoxyquinolin-4-yl]methanol |
| SMILES | CCCCCCNc1cc(OC)cc2c(CO)ccnc12.CCNCC |
| InChI | InChI=1S/C17H24N2O2.C4H11N/c1-3-4-5-6-8-18-16-11-14(21-2)10-15-13(12-20)7-9-19-17(15)16;1-3-5-4-2/h7,9-11,18,20H,3-6,8,12H2,1-2H3;5H,3-4H2,1-2H3 |
| InChIKey | MGNPFYMQRQUDKI-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 66.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.53 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|