C27H44Cl2N4O2 — CID 13077553
2-ethyl-1-[4-[6-[(6-methoxy-4-methylquinolin-8-yl)amino]hexyl]piperazin-1-yl]butan-1-one;dihydrochloride (PubChem CID 13077553) has the molecular formula C27H44Cl2N4O2 and a molecular weight of 527.58 g/mol. Its IUPAC name is 2-ethyl-1-[4-[6-[(6-methoxy-4-methylquinolin-8-yl)amino]hexyl]piperazin-1-yl]butan-1-one;dihydrochloride.
| Compound Name | 2-ethyl-1-[4-[6-[(6-methoxy-4-methylquinolin-8-yl)amino]hexyl]piperazin-1-yl]butan-1-one;dihydrochloride |
|---|---|
| PubChem CID | 13077553 |
| Molecular Formula | C27H44Cl2N4O2 |
| Molecular Weight | 527.58 g/mol |
| Exact Mass | 526.28 |
| IUPAC Name | 2-ethyl-1-[4-[6-[(6-methoxy-4-methylquinolin-8-yl)amino]hexyl]piperazin-1-yl]butan-1-one;dihydrochloride |
| SMILES | CCC(CC)C(=O)N1CCN(CCCCCCNc2cc(OC)cc3c(C)ccnc23)CC1.Cl.Cl |
| InChI | InChI=1S/C27H42N4O2.2ClH/c1-5-22(6-2)27(32)31-17-15-30(16-18-31)14-10-8-7-9-12-28-25-20-23(33-4)19-24-21(3)11-13-29-26(24)25;;/h11,13,19-20,22,28H,5-10,12,14-18H2,1-4H3;2*1H |
| InChIKey | NVHADOHLVDFIAG-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 57.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.58 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|