C27H44N4O — CID 13077547
6-methoxy-4-methyl-N-[6-[2-methyl-4-(3-methylbutyl)piperazin-1-yl]hexyl]quinolin-8-amine (PubChem CID 13077547) has the molecular formula C27H44N4O and a molecular weight of 440.68 g/mol. Its IUPAC name is 6-methoxy-4-methyl-N-[6-[2-methyl-4-(3-methylbutyl)piperazin-1-yl]hexyl]quinolin-8-amine.
| Compound Name | 6-methoxy-4-methyl-N-[6-[2-methyl-4-(3-methylbutyl)piperazin-1-yl]hexyl]quinolin-8-amine |
|---|---|
| PubChem CID | 13077547 |
| Molecular Formula | C27H44N4O |
| Molecular Weight | 440.68 g/mol |
| Exact Mass | 440.35 |
| IUPAC Name | 6-methoxy-4-methyl-N-[6-[2-methyl-4-(3-methylbutyl)piperazin-1-yl]hexyl]quinolin-8-amine |
| SMILES | COc1cc(NCCCCCCN2CCN(CCC(C)C)CC2C)c2nccc(C)c2c1 |
| InChI | InChI=1S/C27H44N4O/c1-21(2)11-15-30-16-17-31(23(4)20-30)14-9-7-6-8-12-28-26-19-24(32-5)18-25-22(3)10-13-29-27(25)26/h10,13,18-19,21,23,28H,6-9,11-12,14-17,20H2,1-5H3 |
| InChIKey | RAAKEEBXYAAUGA-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 40.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.68 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|