C19H29N3O2 — CID 12618404
2-[6-[(6-methoxy-4-methylquinolin-8-yl)amino]hexylamino]ethanol (PubChem CID 12618404) has the molecular formula C19H29N3O2 and a molecular weight of 331.46 g/mol. Its IUPAC name is 2-[6-[(6-methoxy-4-methylquinolin-8-yl)amino]hexylamino]ethanol.
| Compound Name | 2-[6-[(6-methoxy-4-methylquinolin-8-yl)amino]hexylamino]ethanol |
|---|---|
| PubChem CID | 12618404 |
| Molecular Formula | C19H29N3O2 |
| Molecular Weight | 331.46 g/mol |
| Exact Mass | 331.23 |
| IUPAC Name | 2-[6-[(6-methoxy-4-methylquinolin-8-yl)amino]hexylamino]ethanol |
| SMILES | COc1cc(NCCCCCCNCCO)c2nccc(C)c2c1 |
| InChI | InChI=1S/C19H29N3O2/c1-15-7-10-22-19-17(15)13-16(24-2)14-18(19)21-9-6-4-3-5-8-20-11-12-23/h7,10,13-14,20-21,23H,3-6,8-9,11-12H2,1-2H3 |
| InChIKey | DEEGRHPORAVZTA-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 66.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.46 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|