C22H32N4O3 — CID 70431033
[4-[6-[(6-methoxy-4-methylquinolin-8-yl)amino]hexyl]piperazin-1-yl] formate (PubChem CID 70431033) has the molecular formula C22H32N4O3 and a molecular weight of 400.52 g/mol. Its IUPAC name is [4-[6-[(6-methoxy-4-methylquinolin-8-yl)amino]hexyl]piperazin-1-yl] formate.
| Compound Name | [4-[6-[(6-methoxy-4-methylquinolin-8-yl)amino]hexyl]piperazin-1-yl] formate |
|---|---|
| PubChem CID | 70431033 |
| Molecular Formula | C22H32N4O3 |
| Molecular Weight | 400.52 g/mol |
| Exact Mass | 400.25 |
| IUPAC Name | [4-[6-[(6-methoxy-4-methylquinolin-8-yl)amino]hexyl]piperazin-1-yl] formate |
| SMILES | COc1cc(NCCCCCCN2CCN(OC=O)CC2)c2nccc(C)c2c1 |
| InChI | InChI=1S/C22H32N4O3/c1-18-7-9-24-22-20(18)15-19(28-2)16-21(22)23-8-5-3-4-6-10-25-11-13-26(14-12-25)29-17-27/h7,9,15-17,23H,3-6,8,10-14H2,1-2H3 |
| InChIKey | PFGPDFSJTMJZQP-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 66.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.52 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|