C16H23N3O2 — CID 10589528
N-(6,8-dimethoxyquinolin-4-yl)-N',N'-dimethylpropane-1,3-diamine (PubChem CID 10589528) has the molecular formula C16H23N3O2 and a molecular weight of 289.38 g/mol. Its IUPAC name is N-(6,8-dimethoxyquinolin-4-yl)-N',N'-dimethylpropane-1,3-diamine.
| Compound Name | N-(6,8-dimethoxyquinolin-4-yl)-N',N'-dimethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 10589528 |
| Molecular Formula | C16H23N3O2 |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.18 |
| IUPAC Name | N-(6,8-dimethoxyquinolin-4-yl)-N',N'-dimethylpropane-1,3-diamine |
| SMILES | COc1cc(OC)c2nccc(NCCCN(C)C)c2c1 |
| InChI | InChI=1S/C16H23N3O2/c1-19(2)9-5-7-17-14-6-8-18-16-13(14)10-12(20-3)11-15(16)21-4/h6,8,10-11H,5,7,9H2,1-4H3,(H,17,18) |
| InChIKey | FDIPIIZTNMRTQI-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 46.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|