C23H34N6 — CID 13133598
4-N,10-N-bis[3-(dimethylamino)propyl]-6-methyl-1,7-phenanthroline-4,10-diamine (PubChem CID 13133598) has the molecular formula C23H34N6 and a molecular weight of 394.57 g/mol. Its IUPAC name is 4-N,10-N-bis[3-(dimethylamino)propyl]-6-methyl-1,7-phenanthroline-4,10-diamine.
| Compound Name | 4-N,10-N-bis[3-(dimethylamino)propyl]-6-methyl-1,7-phenanthroline-4,10-diamine |
|---|---|
| PubChem CID | 13133598 |
| Molecular Formula | C23H34N6 |
| Molecular Weight | 394.57 g/mol |
| Exact Mass | 394.28 |
| IUPAC Name | 4-N,10-N-bis[3-(dimethylamino)propyl]-6-methyl-1,7-phenanthroline-4,10-diamine |
| SMILES | Cc1cc2c(NCCCN(C)C)ccnc2c2c(NCCCN(C)C)ccnc12 |
| InChI | InChI=1S/C23H34N6/c1-17-16-18-19(24-10-6-14-28(2)3)8-12-27-23(18)21-20(9-13-26-22(17)21)25-11-7-15-29(4)5/h8-9,12-13,16H,6-7,10-11,14-15H2,1-5H3,(H,24,27)(H,25,26) |
| InChIKey | FLUWHFDPBJUAEQ-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 56.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.57 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|