C15H22ClN5O2 — CID 5388836
4-N-[3-(dimethylamino)propyl]-8-N-methyl-5-nitroquinoline-4,8-diamine;hydrochloride (PubChem CID 5388836) has the molecular formula C15H22ClN5O2 and a molecular weight of 339.83 g/mol. Its IUPAC name is 4-N-[3-(dimethylamino)propyl]-8-N-methyl-5-nitroquinoline-4,8-diamine;hydrochloride.
| Compound Name | 4-N-[3-(dimethylamino)propyl]-8-N-methyl-5-nitroquinoline-4,8-diamine;hydrochloride |
|---|---|
| PubChem CID | 5388836 |
| Molecular Formula | C15H22ClN5O2 |
| Molecular Weight | 339.83 g/mol |
| Exact Mass | 339.15 |
| IUPAC Name | 4-N-[3-(dimethylamino)propyl]-8-N-methyl-5-nitroquinoline-4,8-diamine;hydrochloride |
| SMILES | CNc1ccc([N+](=O)[O-])c2c(NCCCN(C)C)ccnc12.Cl |
| InChI | InChI=1S/C15H21N5O2.ClH/c1-16-12-5-6-13(20(21)22)14-11(7-9-18-15(12)14)17-8-4-10-19(2)3;/h5-7,9,16H,4,8,10H2,1-3H3,(H,17,18);1H |
| InChIKey | QPOWEKHGFUCZFK-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 83.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.83 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|