C15H20N4O3 — CID 6711800
N,N-dimethyl-3-[(8-methyl-5-nitroquinolin-4-yl)amino]propan-1-amine oxide (PubChem CID 6711800) has the molecular formula C15H20N4O3 and a molecular weight of 304.35 g/mol. Its IUPAC name is N,N-dimethyl-3-[(8-methyl-5-nitroquinolin-4-yl)amino]propan-1-amine oxide.
| Compound Name | N,N-dimethyl-3-[(8-methyl-5-nitroquinolin-4-yl)amino]propan-1-amine oxide |
|---|---|
| PubChem CID | 6711800 |
| Molecular Formula | C15H20N4O3 |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.15 |
| IUPAC Name | N,N-dimethyl-3-[(8-methyl-5-nitroquinolin-4-yl)amino]propan-1-amine oxide |
| SMILES | Cc1ccc([N+](=O)[O-])c2c(NCCC[N+](C)(C)[O-])ccnc12 |
| InChI | InChI=1S/C15H20N4O3/c1-11-5-6-13(18(20)21)14-12(7-9-17-15(11)14)16-8-4-10-19(2,3)22/h5-7,9H,4,8,10H2,1-3H3,(H,16,17) |
| InChIKey | RYBRSYXJJMOYNC-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 91.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|