C14H19Cl2N4O3- — CID 54608931
N,N-dimethyl-3-[(5-nitroquinolin-4-yl)amino]propan-1-amine oxide;chloride;hydrochloride (PubChem CID 54608931) has the molecular formula C14H19Cl2N4O3- and a molecular weight of 362.24 g/mol. Its IUPAC name is N,N-dimethyl-3-[(5-nitroquinolin-4-yl)amino]propan-1-amine oxide;chloride;hydrochloride.
| Compound Name | N,N-dimethyl-3-[(5-nitroquinolin-4-yl)amino]propan-1-amine oxide;chloride;hydrochloride |
|---|---|
| PubChem CID | 54608931 |
| Molecular Formula | C14H19Cl2N4O3- |
| Molecular Weight | 362.24 g/mol |
| Exact Mass | 361.08 |
| IUPAC Name | N,N-dimethyl-3-[(5-nitroquinolin-4-yl)amino]propan-1-amine oxide;chloride;hydrochloride |
| SMILES | C[N+](C)([O-])CCCNc1ccnc2cccc([N+](=O)[O-])c12.Cl.[Cl-] |
| InChI | InChI=1S/C14H18N4O3.2ClH/c1-18(2,21)10-4-8-15-12-7-9-16-11-5-3-6-13(14(11)12)17(19)20;;/h3,5-7,9H,4,8,10H2,1-2H3,(H,15,16);2*1H/p-1 |
| InChIKey | QVCHPUXZYKVCQG-UHFFFAOYSA-M |
| XLogP | -0.05 |
| TPSA | 91.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.24 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|