About N-methylmethanamine;5-nitro-N-propylquinolin-4-amine
N-methylmethanamine;5-nitro-N-propylquinolin-4-amine (PubChem CID 69400759) has the molecular formula C14H20N4O2
and a molecular weight of 276.34 g/mol. Its IUPAC name is N-methylmethanamine;5-nitro-N-propylquinolin-4-amine.
Molecular Properties
| Compound Name | N-methylmethanamine;5-nitro-N-propylquinolin-4-amine |
| PubChem CID | 69400759 |
| Molecular Formula | C14H20N4O2 |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.16 |
| IUPAC Name | N-methylmethanamine;5-nitro-N-propylquinolin-4-amine |
| SMILES | CCCNc1ccnc2cccc([N+](=O)[O-])c12.CNC |
| InChI | InChI=1S/C12H13N3O2.C2H7N/c1-2-7-13-10-6-8-14-9-4-3-5-11(12(9)10)15(16)17;1-3-2/h3-6,8H,2,7H2,1H3,(H,13,14);3H,1-2H3 |
| InChIKey | DSHNTROGJVRKOD-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 80.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-methylmethanamine;5-nitro-N-propylquinolin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methylmethanamine;5-nitro-N-propylquinolin-4-amine?
The IUPAC name of N-methylmethanamine;5-nitro-N-propylquinolin-4-amine (CID 69400759) is N-methylmethanamine;5-nitro-N-propylquinolin-4-amine.
What is the SMILES notation for N-methylmethanamine;5-nitro-N-propylquinolin-4-amine?
The canonical SMILES for N-methylmethanamine;5-nitro-N-propylquinolin-4-amine is CCCNc1ccnc2cccc([N+](=O)[O-])c12.CNC.
What is the InChIKey of N-methylmethanamine;5-nitro-N-propylquinolin-4-amine?
The InChIKey is DSHNTROGJVRKOD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13N3O2.C2H7N/c1-2-7-13-10-6-8-14-9-4-3-5-11(12(9)10)15(16)17;1-3-2/h3-6,8H,2,7H2,1H3,(H,13,14);3H,1-2H3.
What are the key properties of N-methylmethanamine;5-nitro-N-propylquinolin-4-amine?
N-methylmethanamine;5-nitro-N-propylquinolin-4-amine has a molecular weight of 276.34 g/mol, XLogP of 2.80, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-methylmethanamine;5-nitro-N-propylquinolin-4-amine is sourced from PubChem (CID 69400759), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).