C21H21N3O — CID 52953208
12-[3-(dimethylamino)propylamino]-16-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,9(17),10,12,14-octaen-8-one (PubChem CID 52953208) has the molecular formula C21H21N3O and a molecular weight of 331.42 g/mol. Its IUPAC name is 12-[3-(dimethylamino)propylamino]-16-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,9(17),10,12,14-octaen-8-one.
| Compound Name | 12-[3-(dimethylamino)propylamino]-16-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,9(17),10,12,14-octaen-8-one |
|---|---|
| PubChem CID | 52953208 |
| Molecular Formula | C21H21N3O |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 331.17 |
| IUPAC Name | 12-[3-(dimethylamino)propylamino]-16-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,9(17),10,12,14-octaen-8-one |
| SMILES | CN(C)CCCNc1ccc2c3c(nccc13)-c1ccccc1C2=O |
| InChI | InChI=1S/C21H21N3O/c1-24(2)13-5-11-22-18-9-8-17-19-16(18)10-12-23-20(19)14-6-3-4-7-15(14)21(17)25/h3-4,6-10,12,22H,5,11,13H2,1-2H3 |
| InChIKey | ZBMIZTIAZBZING-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|