C15H18Cl2N2O2 — CID 138111169
2-chloro-3-[3-(dimethylamino)propylamino]naphthalene-1,4-dione;hydrochloride (PubChem CID 138111169) has the molecular formula C15H18Cl2N2O2 and a molecular weight of 329.23 g/mol. Its IUPAC name is 2-chloro-3-[3-(dimethylamino)propylamino]naphthalene-1,4-dione;hydrochloride.
| Compound Name | 2-chloro-3-[3-(dimethylamino)propylamino]naphthalene-1,4-dione;hydrochloride |
|---|---|
| PubChem CID | 138111169 |
| Molecular Formula | C15H18Cl2N2O2 |
| Molecular Weight | 329.23 g/mol |
| Exact Mass | 328.07 |
| IUPAC Name | 2-chloro-3-[3-(dimethylamino)propylamino]naphthalene-1,4-dione;hydrochloride |
| SMILES | CN(C)CCCNC1=C(Cl)C(=O)c2ccccc2C1=O.Cl |
| InChI | InChI=1S/C15H17ClN2O2.ClH/c1-18(2)9-5-8-17-13-12(16)14(19)10-6-3-4-7-11(10)15(13)20;/h3-4,6-7,17H,5,8-9H2,1-2H3;1H |
| InChIKey | YHAFHEHDTMYZPO-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.23 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|