C38H54Cl2N4O4 — CID 23624875
2,5-dichloro-3,6-bis[6-[ethyl-[(2-methoxyphenyl)methyl]amino]hexylamino]cyclohexa-2,5-diene-1,4-dione (PubChem CID 23624875) has the molecular formula C38H54Cl2N4O4 and a molecular weight of 701.78 g/mol. Its IUPAC name is 2,5-dichloro-3,6-bis[6-[ethyl-[(2-methoxyphenyl)methyl]amino]hexylamino]cyclohexa-2,5-diene-1,4-dione.
| Compound Name | 2,5-dichloro-3,6-bis[6-[ethyl-[(2-methoxyphenyl)methyl]amino]hexylamino]cyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 23624875 |
| Molecular Formula | C38H54Cl2N4O4 |
| Molecular Weight | 701.78 g/mol |
| Exact Mass | 700.35 |
| IUPAC Name | 2,5-dichloro-3,6-bis[6-[ethyl-[(2-methoxyphenyl)methyl]amino]hexylamino]cyclohexa-2,5-diene-1,4-dione |
| SMILES | CCN(CCCCCCNC1=C(Cl)C(=O)C(NCCCCCCN(CC)Cc2ccccc2OC)=C(Cl)C1=O)Cc1ccccc1OC |
| InChI | InChI=1S/C38H54Cl2N4O4/c1-5-43(27-29-19-11-13-21-31(29)47-3)25-17-9-7-15-23-41-35-33(39)38(46)36(34(40)37(35)45)42-24-16-8-10-18-26-44(6-2)28-30-20-12-14-22-32(30)48-4/h11-14,19-22,41-42H,5-10,15-18,23-28H2,1-4H3 |
| InChIKey | OJNIVWNIMGRIAQ-UHFFFAOYSA-N |
| XLogP | 7.40 |
| TPSA | 83.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 701.78 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|