C17H30N2O3 — CID 159616458
methyl N-[2-[ethyl-[(2-methoxyphenyl)methyl]amino]ethyl]carbamate;propane (PubChem CID 159616458) has the molecular formula C17H30N2O3 and a molecular weight of 310.44 g/mol. Its IUPAC name is methyl N-[2-[ethyl-[(2-methoxyphenyl)methyl]amino]ethyl]carbamate;propane.
| Compound Name | methyl N-[2-[ethyl-[(2-methoxyphenyl)methyl]amino]ethyl]carbamate;propane |
|---|---|
| PubChem CID | 159616458 |
| Molecular Formula | C17H30N2O3 |
| Molecular Weight | 310.44 g/mol |
| Exact Mass | 310.23 |
| IUPAC Name | methyl N-[2-[ethyl-[(2-methoxyphenyl)methyl]amino]ethyl]carbamate;propane |
| SMILES | CCC.CCN(CCNC(=O)OC)Cc1ccccc1OC |
| InChI | InChI=1S/C14H22N2O3.C3H8/c1-4-16(10-9-15-14(17)19-3)11-12-7-5-6-8-13(12)18-2;1-3-2/h5-8H,4,9-11H2,1-3H3,(H,15,17);3H2,1-2H3 |
| InChIKey | MNIPMHTWMRZPDL-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.44 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |