C25H36ClNO4 — CID 19921887
1-(3,4-dimethoxyphenyl)-7-[ethyl-[(2-methoxyphenyl)methyl]amino]heptan-1-one;hydrochloride (PubChem CID 19921887) has the molecular formula C25H36ClNO4 and a molecular weight of 450.02 g/mol. Its IUPAC name is 1-(3,4-dimethoxyphenyl)-7-[ethyl-[(2-methoxyphenyl)methyl]amino]heptan-1-one;hydrochloride.
| Compound Name | 1-(3,4-dimethoxyphenyl)-7-[ethyl-[(2-methoxyphenyl)methyl]amino]heptan-1-one;hydrochloride |
|---|---|
| PubChem CID | 19921887 |
| Molecular Formula | C25H36ClNO4 |
| Molecular Weight | 450.02 g/mol |
| Exact Mass | 449.23 |
| IUPAC Name | 1-(3,4-dimethoxyphenyl)-7-[ethyl-[(2-methoxyphenyl)methyl]amino]heptan-1-one;hydrochloride |
| SMILES | CCN(CCCCCCC(=O)c1ccc(OC)c(OC)c1)Cc1ccccc1OC.Cl |
| InChI | InChI=1S/C25H35NO4.ClH/c1-5-26(19-21-12-9-10-14-23(21)28-2)17-11-7-6-8-13-22(27)20-15-16-24(29-3)25(18-20)30-4;/h9-10,12,14-16,18H,5-8,11,13,17,19H2,1-4H3;1H |
| InChIKey | QPDVPHUJUSXPGG-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.02 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|