C36H60Br2N4O4 — CID 70405503
bromomethane;[2-[[10-[[2-(dimethylcarbamoyloxy)phenyl]methyl-ethylamino]decyl-ethylamino]methyl]phenyl] N,N-dimethylcarbamate (PubChem CID 70405503) has the molecular formula C36H60Br2N4O4 and a molecular weight of 772.71 g/mol. Its IUPAC name is bromomethane;[2-[[10-[[2-(dimethylcarbamoyloxy)phenyl]methyl-ethylamino]decyl-ethylamino]methyl]phenyl] N,N-dimethylcarbamate.
| Compound Name | bromomethane;[2-[[10-[[2-(dimethylcarbamoyloxy)phenyl]methyl-ethylamino]decyl-ethylamino]methyl]phenyl] N,N-dimethylcarbamate |
|---|---|
| PubChem CID | 70405503 |
| Molecular Formula | C36H60Br2N4O4 |
| Molecular Weight | 772.71 g/mol |
| Exact Mass | 770.30 |
| IUPAC Name | bromomethane;[2-[[10-[[2-(dimethylcarbamoyloxy)phenyl]methyl-ethylamino]decyl-ethylamino]methyl]phenyl] N,N-dimethylcarbamate |
| SMILES | CBr.CBr.CCN(CCCCCCCCCCN(CC)Cc1ccccc1OC(=O)N(C)C)Cc1ccccc1OC(=O)N(C)C |
| InChI | InChI=1S/C34H54N4O4.2CH3Br/c1-7-37(27-29-21-15-17-23-31(29)41-33(39)35(3)4)25-19-13-11-9-10-12-14-20-26-38(8-2)28-30-22-16-18-24-32(30)42-34(40)36(5)6;2*1-2/h15-18,21-24H,7-14,19-20,25-28H2,1-6H3;2*1H3 |
| InChIKey | LCXCGFOQELUAIC-UHFFFAOYSA-N |
| XLogP | 9.29 |
| TPSA | 65.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 772.71 |
| LogP ≤ 5 | 9.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|