C26H33NO6 — CID 10004162
2-[4-[ethyl-[(2-methoxyphenyl)methyl]amino]butyl]-5,6-dimethoxy-3-oxo-1H-indene-2-carboxylic acid (PubChem CID 10004162) has the molecular formula C26H33NO6 and a molecular weight of 455.55 g/mol. Its IUPAC name is 2-[4-[ethyl-[(2-methoxyphenyl)methyl]amino]butyl]-5,6-dimethoxy-3-oxo-1H-indene-2-carboxylic acid.
| Compound Name | 2-[4-[ethyl-[(2-methoxyphenyl)methyl]amino]butyl]-5,6-dimethoxy-3-oxo-1H-indene-2-carboxylic acid |
|---|---|
| PubChem CID | 10004162 |
| Molecular Formula | C26H33NO6 |
| Molecular Weight | 455.55 g/mol |
| Exact Mass | 455.23 |
| IUPAC Name | 2-[4-[ethyl-[(2-methoxyphenyl)methyl]amino]butyl]-5,6-dimethoxy-3-oxo-1H-indene-2-carboxylic acid |
| SMILES | CCN(CCCCC1(C(=O)O)Cc2cc(OC)c(OC)cc2C1=O)Cc1ccccc1OC |
| InChI | InChI=1S/C26H33NO6/c1-5-27(17-18-10-6-7-11-21(18)31-2)13-9-8-12-26(25(29)30)16-19-14-22(32-3)23(33-4)15-20(19)24(26)28/h6-7,10-11,14-15H,5,8-9,12-13,16-17H2,1-4H3,(H,29,30) |
| InChIKey | ZZCQUHYOFQDWHJ-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.55 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|