C24H40N2O2S2 — CID 11698149
5-(dithiolan-3-yl)-N-[6-[ethyl-[(2-methoxyphenyl)methyl]amino]hexyl]pentanamide (PubChem CID 11698149) has the molecular formula C24H40N2O2S2 and a molecular weight of 452.73 g/mol. Its IUPAC name is 5-(dithiolan-3-yl)-N-[6-[ethyl-[(2-methoxyphenyl)methyl]amino]hexyl]pentanamide.
| Compound Name | 5-(dithiolan-3-yl)-N-[6-[ethyl-[(2-methoxyphenyl)methyl]amino]hexyl]pentanamide |
|---|---|
| PubChem CID | 11698149 |
| Molecular Formula | C24H40N2O2S2 |
| Molecular Weight | 452.73 g/mol |
| Exact Mass | 452.25 |
| IUPAC Name | 5-(dithiolan-3-yl)-N-[6-[ethyl-[(2-methoxyphenyl)methyl]amino]hexyl]pentanamide |
| SMILES | CCN(CCCCCCNC(=O)CCCCC1CCSS1)Cc1ccccc1OC |
| InChI | InChI=1S/C24H40N2O2S2/c1-3-26(20-21-12-6-8-14-23(21)28-2)18-11-5-4-10-17-25-24(27)15-9-7-13-22-16-19-29-30-22/h6,8,12,14,22H,3-5,7,9-11,13,15-20H2,1-2H3,(H,25,27) |
| InChIKey | PAPNIDWABUXIRG-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.73 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|