C38H56N4O2 — CID 23625036
2,5-bis[6-[ethyl-[(2-methylphenyl)methyl]amino]hexylamino]cyclohexa-2,5-diene-1,4-dione (PubChem CID 23625036) has the molecular formula C38H56N4O2 and a molecular weight of 600.89 g/mol. Its IUPAC name is 2,5-bis[6-[ethyl-[(2-methylphenyl)methyl]amino]hexylamino]cyclohexa-2,5-diene-1,4-dione.
| Compound Name | 2,5-bis[6-[ethyl-[(2-methylphenyl)methyl]amino]hexylamino]cyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 23625036 |
| Molecular Formula | C38H56N4O2 |
| Molecular Weight | 600.89 g/mol |
| Exact Mass | 600.44 |
| IUPAC Name | 2,5-bis[6-[ethyl-[(2-methylphenyl)methyl]amino]hexylamino]cyclohexa-2,5-diene-1,4-dione |
| SMILES | CCN(CCCCCCNC1=CC(=O)C(NCCCCCCN(CC)Cc2ccccc2C)=CC1=O)Cc1ccccc1C |
| InChI | InChI=1S/C38H56N4O2/c1-5-41(29-33-21-13-11-19-31(33)3)25-17-9-7-15-23-39-35-27-38(44)36(28-37(35)43)40-24-16-8-10-18-26-42(6-2)30-34-22-14-12-20-32(34)4/h11-14,19-22,27-28,39-40H,5-10,15-18,23-26,29-30H2,1-4H3 |
| InChIKey | FJCJZHJMWARDKI-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.89 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|