C13H15NO4 — CID 86168080
3-methyl-6-phenyl-3a,4,8,8a-tetrahydro-[1,3]dioxepino[5,6-d][1,3]oxazol-2-one (PubChem CID 86168080) has the molecular formula C13H15NO4 and a molecular weight of 249.27 g/mol. Its IUPAC name is 3-methyl-6-phenyl-3a,4,8,8a-tetrahydro-[1,3]dioxepino[5,6-d][1,3]oxazol-2-one.
| Compound Name | 3-methyl-6-phenyl-3a,4,8,8a-tetrahydro-[1,3]dioxepino[5,6-d][1,3]oxazol-2-one |
|---|---|
| PubChem CID | 86168080 |
| Molecular Formula | C13H15NO4 |
| Molecular Weight | 249.27 g/mol |
| Exact Mass | 249.10 |
| IUPAC Name | 3-methyl-6-phenyl-3a,4,8,8a-tetrahydro-[1,3]dioxepino[5,6-d][1,3]oxazol-2-one |
| SMILES | CN1C(=O)OC2COC(c3ccccc3)OCC21 |
| InChI | InChI=1S/C13H15NO4/c1-14-10-7-16-12(9-5-3-2-4-6-9)17-8-11(10)18-13(14)15/h2-6,10-12H,7-8H2,1H3 |
| InChIKey | ARDTTZKRDHLIJR-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.27 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |