C12H14O6S — CID 89332638
(4R,4aS)-4-methyl-6-phenyl-4,4a,8,8a-tetrahydro-[1,3]dioxino[5,4-d][1,3,2]dioxathiine 2,2-dioxide (PubChem CID 89332638) has the molecular formula C12H14O6S and a molecular weight of 286.31 g/mol. Its IUPAC name is (4R,4aS)-4-methyl-6-phenyl-4,4a,8,8a-tetrahydro-[1,3]dioxino[5,4-d][1,3,2]dioxathiine 2,2-dioxide.
| Compound Name | (4R,4aS)-4-methyl-6-phenyl-4,4a,8,8a-tetrahydro-[1,3]dioxino[5,4-d][1,3,2]dioxathiine 2,2-dioxide |
|---|---|
| PubChem CID | 89332638 |
| Molecular Formula | C12H14O6S |
| Molecular Weight | 286.31 g/mol |
| Exact Mass | 286.05 |
| IUPAC Name | (4R,4aS)-4-methyl-6-phenyl-4,4a,8,8a-tetrahydro-[1,3]dioxino[5,4-d][1,3,2]dioxathiine 2,2-dioxide |
| SMILES | C[C@H]1OS(=O)(=O)OC2COC(c3ccccc3)O[C@H]21 |
| InChI | InChI=1S/C12H14O6S/c1-8-11-10(18-19(13,14)17-8)7-15-12(16-11)9-5-3-2-4-6-9/h2-6,8,10-12H,7H2,1H3/t8-,10?,11+,12?/m1/s1 |
| InChIKey | VBBFASDFVXZVPO-JZLCVZKOSA-N |
| XLogP | 1.15 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.31 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |