C12H16O9P2 — CID 11291516
(6aR,8S,10aS)-2,4-dihydroxy-10a-methyl-8-phenyl-6a,10-dihydro-6H-[1,3]dioxino[5,4-f][1,3,5,2,4]trioxadiphosphocine 2,4-dioxide (PubChem CID 11291516) has the molecular formula C12H16O9P2 and a molecular weight of 366.20 g/mol. Its IUPAC name is (6aR,8S,10aS)-2,4-dihydroxy-10a-methyl-8-phenyl-6a,10-dihydro-6H-[1,3]dioxino[5,4-f][1,3,5,2,4]trioxadiphosphocine 2,4-dioxide.
| Compound Name | (6aR,8S,10aS)-2,4-dihydroxy-10a-methyl-8-phenyl-6a,10-dihydro-6H-[1,3]dioxino[5,4-f][1,3,5,2,4]trioxadiphosphocine 2,4-dioxide |
|---|---|
| PubChem CID | 11291516 |
| Molecular Formula | C12H16O9P2 |
| Molecular Weight | 366.20 g/mol |
| Exact Mass | 366.03 |
| IUPAC Name | (6aR,8S,10aS)-2,4-dihydroxy-10a-methyl-8-phenyl-6a,10-dihydro-6H-[1,3]dioxino[5,4-f][1,3,5,2,4]trioxadiphosphocine 2,4-dioxide |
| SMILES | C[C@]12CO[C@H](c3ccccc3)O[C@@H]1COP(=O)(O)OP(=O)(O)O2 |
| InChI | InChI=1S/C12H16O9P2/c1-12-8-17-11(9-5-3-2-4-6-9)19-10(12)7-18-22(13,14)21-23(15,16)20-12/h2-6,10-11H,7-8H2,1H3,(H,13,14)(H,15,16)/t10-,11+,12+/m1/s1 |
| InChIKey | QTFWQKCZHKDUBI-WOPDTQHZSA-N |
| XLogP | 2.12 |
| TPSA | 120.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.20 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|