C8H10O6P2 — CID 129197717
2,4-dihydroxy-6-phenyl-1,5,2λ5,4λ5-dioxadiphosphinane 2,4-dioxide (PubChem CID 129197717) has the molecular formula C8H10O6P2 and a molecular weight of 264.11 g/mol. Its IUPAC name is 2,4-dihydroxy-6-phenyl-1,5,2λ5,4λ5-dioxadiphosphinane 2,4-dioxide.
| Compound Name | 2,4-dihydroxy-6-phenyl-1,5,2λ5,4λ5-dioxadiphosphinane 2,4-dioxide |
|---|---|
| PubChem CID | 129197717 |
| Molecular Formula | C8H10O6P2 |
| Molecular Weight | 264.11 g/mol |
| Exact Mass | 264.00 |
| IUPAC Name | 2,4-dihydroxy-6-phenyl-1,5,2λ5,4λ5-dioxadiphosphinane 2,4-dioxide |
| SMILES | O=P1(O)CP(=O)(O)OC(c2ccccc2)O1 |
| InChI | InChI=1S/C8H10O6P2/c9-15(10)6-16(11,12)14-8(13-15)7-4-2-1-3-5-7/h1-5,8H,6H2,(H,9,10)(H,11,12) |
| InChIKey | KGRIRGCILUQCBC-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.11 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|