C9H12NO2P — CID 25138814
3-hydroxy-2-phenyl-1,3λ5-azaphospholidine 3-oxide (PubChem CID 25138814) has the molecular formula C9H12NO2P and a molecular weight of 197.17 g/mol. Its IUPAC name is 3-hydroxy-2-phenyl-1,3λ5-azaphospholidine 3-oxide.
| Compound Name | 3-hydroxy-2-phenyl-1,3λ5-azaphospholidine 3-oxide |
|---|---|
| PubChem CID | 25138814 |
| Molecular Formula | C9H12NO2P |
| Molecular Weight | 197.17 g/mol |
| Exact Mass | 197.06 |
| IUPAC Name | 3-hydroxy-2-phenyl-1,3λ5-azaphospholidine 3-oxide |
| SMILES | O=P1(O)CCNC1c1ccccc1 |
| InChI | InChI=1S/C9H12NO2P/c11-13(12)7-6-10-9(13)8-4-2-1-3-5-8/h1-5,9-10H,6-7H2,(H,11,12) |
| InChIKey | AWLISXZILKGFSI-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.17 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|