C20H24N2O6 — CID 11710810
(2R,3R)-2,3-dihydroxybutanedioic acid;(2S,3S)-2,3-diphenylpiperazine (PubChem CID 11710810) has the molecular formula C20H24N2O6 and a molecular weight of 388.42 g/mol. Its IUPAC name is (2R,3R)-2,3-dihydroxybutanedioic acid;(2S,3S)-2,3-diphenylpiperazine.
| Compound Name | (2R,3R)-2,3-dihydroxybutanedioic acid;(2S,3S)-2,3-diphenylpiperazine |
|---|---|
| PubChem CID | 11710810 |
| Molecular Formula | C20H24N2O6 |
| Molecular Weight | 388.42 g/mol |
| Exact Mass | 388.16 |
| IUPAC Name | (2R,3R)-2,3-dihydroxybutanedioic acid;(2S,3S)-2,3-diphenylpiperazine |
| SMILES | O=C(O)[C@H](O)[C@@H](O)C(=O)O.c1ccc([C@@H]2NCCN[C@H]2c2ccccc2)cc1 |
| InChI | InChI=1S/C16H18N2.C4H6O6/c1-3-7-13(8-4-1)15-16(18-12-11-17-15)14-9-5-2-6-10-14;5-1(3(7)8)2(6)4(9)10/h1-10,15-18H,11-12H2;1-2,5-6H,(H,7,8)(H,9,10)/t15-,16-;1-,2-/m01/s1 |
| InChIKey | QRAZFYIXSLXPJQ-OBQOHFDZSA-N |
| XLogP | 0.54 |
| TPSA | 139.12 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.42 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |