C18H20N2O6 — CID 86753649
(2S,3S)-2,3-dihydroxybutanedioic acid;(1R)-1-pyridin-2-yl-1,2,3,4-tetrahydroisoquinoline (PubChem CID 86753649) has the molecular formula C18H20N2O6 and a molecular weight of 360.37 g/mol. Its IUPAC name is (2S,3S)-2,3-dihydroxybutanedioic acid;(1R)-1-pyridin-2-yl-1,2,3,4-tetrahydroisoquinoline.
| Compound Name | (2S,3S)-2,3-dihydroxybutanedioic acid;(1R)-1-pyridin-2-yl-1,2,3,4-tetrahydroisoquinoline |
|---|---|
| PubChem CID | 86753649 |
| Molecular Formula | C18H20N2O6 |
| Molecular Weight | 360.37 g/mol |
| Exact Mass | 360.13 |
| IUPAC Name | (2S,3S)-2,3-dihydroxybutanedioic acid;(1R)-1-pyridin-2-yl-1,2,3,4-tetrahydroisoquinoline |
| SMILES | O=C(O)[C@@H](O)[C@H](O)C(=O)O.c1ccc([C@@H]2NCCc3ccccc32)nc1 |
| InChI | InChI=1S/C14H14N2.C4H6O6/c1-2-6-12-11(5-1)8-10-16-14(12)13-7-3-4-9-15-13;5-1(3(7)8)2(6)4(9)10/h1-7,9,14,16H,8,10H2;1-2,5-6H,(H,7,8)(H,9,10)/t14-;1-,2-/m10/s1 |
| InChIKey | FGIKXANSVZXSAF-FYEOGULHSA-N |
| XLogP | 0.19 |
| TPSA | 139.98 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.37 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |