(2S)-2-(1,2,3,4-tetrahydroisoquinolin-1-ylamino)propanoic acid

C12H16N2O2 — CID 165129461

IUPAC(2S)-2-(1,2,3,4-tetrahydroisoquinolin-1-ylamino)propanoic acid
SMILESC[C@H](NC1NCCc2ccccc21)C(=O)O
InChIInChI=1S/C12H16N2O2/c1-8(12(15)16)14-11-10-5-3-2-4-9(10)6-7-13-11/h2-5,8,11,13-14H,6-7H2,1H3,(H,15,16)/t8-,11?/m0/s1
InChIKeyYNEADLYADZXVDK-YMNIQAILSA-N
MW220.27 g/mol
LogP0.89
Rot. Bonds3

About (2S)-2-(1,2,3,4-tetrahydroisoquinolin-1-ylamino)propanoic acid

(2S)-2-(1,2,3,4-tetrahydroisoquinolin-1-ylamino)propanoic acid (PubChem CID 165129461) has the molecular formula C12H16N2O2 and a molecular weight of 220.27 g/mol. Its IUPAC name is (2S)-2-(1,2,3,4-tetrahydroisoquinolin-1-ylamino)propanoic acid.

Molecular Properties

Compound Name(2S)-2-(1,2,3,4-tetrahydroisoquinolin-1-ylamino)propanoic acid
PubChem CID165129461
Molecular FormulaC12H16N2O2
Molecular Weight220.27 g/mol
Exact Mass220.12
IUPAC Name(2S)-2-(1,2,3,4-tetrahydroisoquinolin-1-ylamino)propanoic acid
SMILESC[C@H](NC1NCCc2ccccc21)C(=O)O
InChIInChI=1S/C12H16N2O2/c1-8(12(15)16)14-11-10-5-3-2-4-9(10)6-7-13-11/h2-5,8,11,13-14H,6-7H2,1H3,(H,15,16)/t8-,11?/m0/s1
InChIKeyYNEADLYADZXVDK-YMNIQAILSA-N
XLogP0.89
TPSA61.36 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500220.27
LogP ≤ 50.89
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Analyze (2S)-2-(1,2,3,4-tetrahydroisoquinolin-1-ylamino)propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2S)-2-(1,2,3,4-tetrahydroisoquinolin-1-ylamino)propanoic acid?
The IUPAC name of (2S)-2-(1,2,3,4-tetrahydroisoquinolin-1-ylamino)propanoic acid (CID 165129461) is (2S)-2-(1,2,3,4-tetrahydroisoquinolin-1-ylamino)propanoic acid.
What is the SMILES notation for (2S)-2-(1,2,3,4-tetrahydroisoquinolin-1-ylamino)propanoic acid?
The canonical SMILES for (2S)-2-(1,2,3,4-tetrahydroisoquinolin-1-ylamino)propanoic acid is C[C@H](NC1NCCc2ccccc21)C(=O)O.
What is the InChIKey of (2S)-2-(1,2,3,4-tetrahydroisoquinolin-1-ylamino)propanoic acid?
The InChIKey is YNEADLYADZXVDK-YMNIQAILSA-N. The full InChI is InChI=1S/C12H16N2O2/c1-8(12(15)16)14-11-10-5-3-2-4-9(10)6-7-13-11/h2-5,8,11,13-14H,6-7H2,1H3,(H,15,16)/t8-,11?/m0/s1.
What are the key properties of (2S)-2-(1,2,3,4-tetrahydroisoquinolin-1-ylamino)propanoic acid?
(2S)-2-(1,2,3,4-tetrahydroisoquinolin-1-ylamino)propanoic acid has a molecular weight of 220.27 g/mol, XLogP of 0.89, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-(1,2,3,4-tetrahydroisoquinolin-1-ylamino)propanoic acid is sourced from PubChem (CID 165129461), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).