C12H16N2O2 — CID 165129461
(2S)-2-(1,2,3,4-tetrahydroisoquinolin-1-ylamino)propanoic acid (PubChem CID 165129461) has the molecular formula C12H16N2O2 and a molecular weight of 220.27 g/mol. Its IUPAC name is (2S)-2-(1,2,3,4-tetrahydroisoquinolin-1-ylamino)propanoic acid.
| Compound Name | (2S)-2-(1,2,3,4-tetrahydroisoquinolin-1-ylamino)propanoic acid |
|---|---|
| PubChem CID | 165129461 |
| Molecular Formula | C12H16N2O2 |
| Molecular Weight | 220.27 g/mol |
| Exact Mass | 220.12 |
| IUPAC Name | (2S)-2-(1,2,3,4-tetrahydroisoquinolin-1-ylamino)propanoic acid |
| SMILES | C[C@H](NC1NCCc2ccccc21)C(=O)O |
| InChI | InChI=1S/C12H16N2O2/c1-8(12(15)16)14-11-10-5-3-2-4-9(10)6-7-13-11/h2-5,8,11,13-14H,6-7H2,1H3,(H,15,16)/t8-,11?/m0/s1 |
| InChIKey | YNEADLYADZXVDK-YMNIQAILSA-N |
| XLogP | 0.89 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.27 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |