C14H17NO4 — CID 172701056
(Z)-but-2-enedioic acid;1-methyl-1,2,3,4-tetrahydroisoquinoline (PubChem CID 172701056) has the molecular formula C14H17NO4 and a molecular weight of 263.29 g/mol. Its IUPAC name is (Z)-but-2-enedioic acid;1-methyl-1,2,3,4-tetrahydroisoquinoline.
| Compound Name | (Z)-but-2-enedioic acid;1-methyl-1,2,3,4-tetrahydroisoquinoline |
|---|---|
| PubChem CID | 172701056 |
| Molecular Formula | C14H17NO4 |
| Molecular Weight | 263.29 g/mol |
| Exact Mass | 263.12 |
| IUPAC Name | (Z)-but-2-enedioic acid;1-methyl-1,2,3,4-tetrahydroisoquinoline |
| SMILES | CC1NCCc2ccccc21.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C10H13N.C4H4O4/c1-8-10-5-3-2-4-9(10)6-7-11-8;5-3(6)1-2-4(7)8/h2-5,8,11H,6-7H2,1H3;1-2H,(H,5,6)(H,7,8)/b;2-1- |
| InChIKey | CYWGVZMSHTZJBF-BTJKTKAUSA-N |
| XLogP | 1.61 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.29 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|