C9H11NO2S — CID 57470154
1,2,3,4-tetrahydroisoquinoline-1-sulfinic acid (PubChem CID 57470154) has the molecular formula C9H11NO2S and a molecular weight of 197.26 g/mol. Its IUPAC name is 1,2,3,4-tetrahydroisoquinoline-1-sulfinic acid.
| Compound Name | 1,2,3,4-tetrahydroisoquinoline-1-sulfinic acid |
|---|---|
| PubChem CID | 57470154 |
| Molecular Formula | C9H11NO2S |
| Molecular Weight | 197.26 g/mol |
| Exact Mass | 197.05 |
| IUPAC Name | 1,2,3,4-tetrahydroisoquinoline-1-sulfinic acid |
| SMILES | O=S(O)C1NCCc2ccccc21 |
| InChI | InChI=1S/C9H11NO2S/c11-13(12)9-8-4-2-1-3-7(8)5-6-10-9/h1-4,9-10H,5-6H2,(H,11,12) |
| InChIKey | QOQMJLWHZLOLDH-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.26 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|