C9H11BrClN — CID 174787793
1-bromo-1,2,3,4-tetrahydroisoquinoline;hydrochloride (PubChem CID 174787793) has the molecular formula C9H11BrClN and a molecular weight of 248.55 g/mol. Its IUPAC name is 1-bromo-1,2,3,4-tetrahydroisoquinoline;hydrochloride.
| Compound Name | 1-bromo-1,2,3,4-tetrahydroisoquinoline;hydrochloride |
|---|---|
| PubChem CID | 174787793 |
| Molecular Formula | C9H11BrClN |
| Molecular Weight | 248.55 g/mol |
| Exact Mass | 246.98 |
| IUPAC Name | 1-bromo-1,2,3,4-tetrahydroisoquinoline;hydrochloride |
| SMILES | BrC1NCCc2ccccc21.Cl |
| InChI | InChI=1S/C9H10BrN.ClH/c10-9-8-4-2-1-3-7(8)5-6-11-9;/h1-4,9,11H,5-6H2;1H |
| InChIKey | CEUUHERYRHWNID-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.55 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|