C12H15N — CID 79177948
1-prop-1-en-2-yl-1,2,3,4-tetrahydroisoquinoline (PubChem CID 79177948) has the molecular formula C12H15N and a molecular weight of 173.26 g/mol. Its IUPAC name is 1-prop-1-en-2-yl-1,2,3,4-tetrahydroisoquinoline.
| Compound Name | 1-prop-1-en-2-yl-1,2,3,4-tetrahydroisoquinoline |
|---|---|
| PubChem CID | 79177948 |
| Molecular Formula | C12H15N |
| Molecular Weight | 173.26 g/mol |
| Exact Mass | 173.12 |
| IUPAC Name | 1-prop-1-en-2-yl-1,2,3,4-tetrahydroisoquinoline |
| SMILES | C=C(C)C1NCCc2ccccc21 |
| InChI | InChI=1S/C12H15N/c1-9(2)12-11-6-4-3-5-10(11)7-8-13-12/h3-6,12-13H,1,7-8H2,2H3 |
| InChIKey | QWTAMOAQWJEQBP-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.26 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|