C14H16N2O — CID 114417295
N-but-3-yn-2-yl-1,2,3,4-tetrahydroisoquinoline-1-carboxamide (PubChem CID 114417295) has the molecular formula C14H16N2O and a molecular weight of 228.30 g/mol. Its IUPAC name is N-but-3-yn-2-yl-1,2,3,4-tetrahydroisoquinoline-1-carboxamide.
| Compound Name | N-but-3-yn-2-yl-1,2,3,4-tetrahydroisoquinoline-1-carboxamide |
|---|---|
| PubChem CID | 114417295 |
| Molecular Formula | C14H16N2O |
| Molecular Weight | 228.30 g/mol |
| Exact Mass | 228.13 |
| IUPAC Name | N-but-3-yn-2-yl-1,2,3,4-tetrahydroisoquinoline-1-carboxamide |
| SMILES | C#CC(C)NC(=O)C1NCCc2ccccc21 |
| InChI | InChI=1S/C14H16N2O/c1-3-10(2)16-14(17)13-12-7-5-4-6-11(12)8-9-15-13/h1,4-7,10,13,15H,8-9H2,2H3,(H,16,17) |
| InChIKey | XYLUZLDXFSZMGS-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.30 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|