C14H17N5O — CID 103815072
N-[1-(1H-1,2,4-triazol-5-yl)ethyl]-1,2,3,4-tetrahydroisoquinoline-1-carboxamide (PubChem CID 103815072) has the molecular formula C14H17N5O and a molecular weight of 271.32 g/mol. Its IUPAC name is N-[1-(1H-1,2,4-triazol-5-yl)ethyl]-1,2,3,4-tetrahydroisoquinoline-1-carboxamide.
| Compound Name | N-[1-(1H-1,2,4-triazol-5-yl)ethyl]-1,2,3,4-tetrahydroisoquinoline-1-carboxamide |
|---|---|
| PubChem CID | 103815072 |
| Molecular Formula | C14H17N5O |
| Molecular Weight | 271.32 g/mol |
| Exact Mass | 271.14 |
| IUPAC Name | N-[1-(1H-1,2,4-triazol-5-yl)ethyl]-1,2,3,4-tetrahydroisoquinoline-1-carboxamide |
| SMILES | CC(NC(=O)C1NCCc2ccccc21)c1ncn[nH]1 |
| InChI | InChI=1S/C14H17N5O/c1-9(13-16-8-17-19-13)18-14(20)12-11-5-3-2-4-10(11)6-7-15-12/h2-5,8-9,12,15H,6-7H2,1H3,(H,18,20)(H,16,17,19) |
| InChIKey | UXIUMBHUTREOSJ-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.32 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |