C18H16N2 — CID 54756531
1-[(1R)-1,2,3,4-tetrahydroisoquinolin-1-yl]isoquinoline (PubChem CID 54756531) has the molecular formula C18H16N2 and a molecular weight of 260.34 g/mol. Its IUPAC name is 1-[(1R)-1,2,3,4-tetrahydroisoquinolin-1-yl]isoquinoline.
| Compound Name | 1-[(1R)-1,2,3,4-tetrahydroisoquinolin-1-yl]isoquinoline |
|---|---|
| PubChem CID | 54756531 |
| Molecular Formula | C18H16N2 |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.13 |
| IUPAC Name | 1-[(1R)-1,2,3,4-tetrahydroisoquinolin-1-yl]isoquinoline |
| SMILES | c1ccc2c(c1)CCN[C@H]2c1nccc2ccccc12 |
| InChI | InChI=1S/C18H16N2/c1-3-7-15-13(5-1)9-11-19-17(15)18-16-8-4-2-6-14(16)10-12-20-18/h1-9,11,18,20H,10,12H2/t18-/m1/s1 |
| InChIKey | PFDLMXVQNMYIRQ-GOSISDBHSA-N |
| XLogP | 3.47 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |